EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1O[C@@](O)(CO)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha122h-2a_2-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4-,5+,6+/m1/s1 |
| InChIKey | RFSUNEUAIZKAJO-ZXXMMSQZSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-fructofuranose (CHEBI:37720) is a D-fructofuranose (CHEBI:37721) |
| α-D-fructofuranose (CHEBI:37720) is enantiomer of α-L-fructofuranose (CHEBI:37727) |
| Incoming Relation(s) |
| α-D-fructofuranose 1,6-bisphosphate (CHEBI:40595) has functional parent α-D-fructofuranose (CHEBI:37720) |
| α-D-fructofuranose-β-D-fructofuranose 2',1:2,3'-dianhydride (CHEBI:192285) has functional parent α-D-fructofuranose (CHEBI:37720) |
| α-D-fructuronic acid (CHEBI:47948) has functional parent α-D-fructofuranose (CHEBI:37720) |
| α-L-fructofuranose (CHEBI:37727) is enantiomer of α-D-fructofuranose (CHEBI:37720) |
| IUPAC Name |
|---|
| α-D-fructofuranose |
| UniProt Name | Source |
|---|---|
| α-D-fructose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1680729 | Beilstein |