EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11NO2 |
| Net Charge | 0 |
| Average Mass | 225.247 |
| Monoisotopic Mass | 225.07898 |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11NO2/c16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H/b7-6+ |
| InChIKey | ZISCOWXWCHUSMH-VOTSOKGWSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-nitrostilbene (CHEBI:377106) has role mutagen (CHEBI:25435) |
| (E)-4-nitrostilbene (CHEBI:377106) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 1-nitro-4-[(E)-2-phenylethenyl]benzene |
| Synonyms | Source |
|---|---|
| 1-nitro-4-[(E)-2-phenylvinyl]benzene | ChEBI |
| 1-nitro-4-[(E)-2-phenylvinyl]benzene | IUPAC |
| 1-Nitro-4-styryl-benzene | ChEMBL |
| (E)-1-Nitro-4-(2-phenylethenyl)benzene | ChemIDplus |
| (E)-4-Nitrostilbene | KEGG COMPOUND |
| trans-4-Nitrostilbene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14662 | KEGG COMPOUND |
| LMPK13090020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1311157 | Reaxys |
| CAS:1694-20-8 | KEGG COMPOUND |
| CAS:1694-20-8 | ChemIDplus |