EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1O[C@H](O)[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2211h-1b_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6-/m0/s1 |
| InChIKey | WQZGKKKJIJFFOK-YJRYQGEOSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-mannose (CHEBI:37679) is a L-mannopyranose (CHEBI:37677) |
| β-L-mannose (CHEBI:37679) is enantiomer of β-D-mannose (CHEBI:28563) |
| Incoming Relation(s) |
| β-D-mannose (CHEBI:28563) is enantiomer of β-L-mannose (CHEBI:37679) |
| IUPAC Name |
|---|
| β-L-mannopyranose |