EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O5 |
| Net Charge | 0 |
| Average Mass | 390.520 |
| Monoisotopic Mass | 390.24062 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@]4(O)CC[C@H](C5=CC(=O)OC5)[C@@]4(C)C[C@@H](O)[C@]3([H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C23H34O5/c1-21-7-5-15(24)10-14(21)3-4-17-20(21)18(25)11-22(2)16(6-8-23(17,22)27)13-9-19(26)28-12-13/h9,14-18,20,24-25,27H,3-8,10-12H2,1-2H3/t14-,15+,16-,17-,18-,20-,21+,22-,23+/m1/s1 |
| InChIKey | FLMSQRUGSHIKCT-DDZQJACLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mallotus nudiflorus (ncbitaxon:300977) | bark (BTO:0001301) | DOI (10.1002/hlca.200590219) | Found in stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarmentogenin (CHEBI:37665) has parent hydride 5β-cardanolide (CHEBI:35542) |
| sarmentogenin (CHEBI:37665) has role plant metabolite (CHEBI:76924) |
| sarmentogenin (CHEBI:37665) is a 11α-hydroxy steroid (CHEBI:19129) |
| sarmentogenin (CHEBI:37665) is a 14β-hydroxy steroid (CHEBI:36862) |
| sarmentogenin (CHEBI:37665) is a 3β-hydroxy steroid (CHEBI:36836) |
| sarmentogenin (CHEBI:37665) is a cardenolides (CHEBI:74634) |
| Incoming Relation(s) |
| divaricoside (CHEBI:4668) has functional parent sarmentogenin (CHEBI:37665) |
| rhodexin A (CHEBI:27481) has functional parent sarmentogenin (CHEBI:37665) |
| IUPAC Name |
|---|
| 3β,11α,14-trihydroxy-5β-card-20(22)-enolide |
| Synonym | Source |
|---|---|
| 11-alpha-Hydroxydigitoxigenin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMST01120024 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96477 | Reaxys |
| CAS:76-28-8 | ChemIDplus |
| Citations |
|---|