EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15Cl2NO |
| Net Charge | 0 |
| Average Mass | 272.175 |
| Monoisotopic Mass | 271.05307 |
| SMILES | C#CCN(C)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO/c1-3-7-16(2)8-4-9-17-13-6-5-11(14)10-12(13)15/h1,5-6,10H,4,7-9H2,2H3 |
| InChIKey | BTFHLQRNAMSNLC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clorgyline (CHEBI:3763) has role antidepressant (CHEBI:35469) |
| clorgyline (CHEBI:3763) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| clorgyline (CHEBI:3763) is a aromatic ether (CHEBI:35618) |
| clorgyline (CHEBI:3763) is a dichlorobenzene (CHEBI:23697) |
| clorgyline (CHEBI:3763) is a terminal acetylenic compound (CHEBI:73477) |
| clorgyline (CHEBI:3763) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[3-(2,4-dichlorophenoxy)propyl]-N-methylprop-2-yn-1-amine |
| INNs | Source |
|---|---|
| clorgilina | ChemIDplus |
| clorgiline | WHO MedNet |
| clorgiline | ChemIDplus |
| clorgilinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| N-(3-(2,4-dichlorophenoxy)propyl)-N-methyl-2-propynylamine | ChemIDplus |
| N-methyl-N-propargyl-3-(2,4-dichlorophenoxy)propylamine | ChEBI |
| M and B 9302 | ChemIDplus |
| M & B 9302 | ChemIDplus |
| M&B 9302 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1976758 | Reaxys |
| CAS:17780-72-2 | ChemIDplus |
| CAS:17780-72-2 | NIST Chemistry WebBook |
| CAS:17780-72-2 | KEGG COMPOUND |
| Citations |
|---|