EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1O[C@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1221h-1b_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | WQZGKKKJIJFFOK-KGJVWPDLSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-galactose (CHEBI:37620) is a L-galactopyranose (CHEBI:37619) |
| β-L-galactose (CHEBI:37620) is enantiomer of β-D-galactose (CHEBI:27667) |
| Incoming Relation(s) |
| isorhamnetin 3-O-β-L-galactopyranoside (CHEBI:75777) has functional parent β-L-galactose (CHEBI:37620) |
| myricetin 3-O-β-L-galactopyranoside (CHEBI:75817) has functional parent β-L-galactose (CHEBI:37620) |
| α-L-galactose 1-phosphate (CHEBI:60465) has functional parent β-L-galactose (CHEBI:37620) |
| β-L-galactose 1-phosphate (CHEBI:53072) has functional parent β-L-galactose (CHEBI:37620) |
| β-L-galactoside (CHEBI:75775) has functional parent β-L-galactose (CHEBI:37620) |
| β-D-galactose (CHEBI:27667) is enantiomer of β-L-galactose (CHEBI:37620) |
| IUPAC Name |
|---|
| β-L-galactopyranose |
| Manual Xrefs | Databases |
|---|---|
| G76622SI | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907370 | Reaxys |