EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO7S |
| Net Charge | 0 |
| Average Mass | 283.302 |
| Monoisotopic Mass | 283.07257 |
| SMILES | N[C@@H](CS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C9H17NO7S/c10-3(8(15)16)2-18-9-7(14)6(13)5(12)4(1-11)17-9/h3-7,9,11-14H,1-2,10H2,(H,15,16)/t3-,4+,5+,6-,7+,9-/m0/s1 |
| InChIKey | WWUVPKJYNTWYIZ-MRXKBSKTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-β-D-glucosyl-L-cysteine (CHEBI:37566) is a S-glycosyl-L-cysteine (CHEBI:22049) |
| S-β-D-glucosyl-L-cysteine (CHEBI:37566) is a thiosugar (CHEBI:73754) |
| IUPAC Name |
|---|
| S-β-D-glucopyranosyl-L-cysteine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8712840 | Beilstein |