EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O8 |
| Net Charge | 0 |
| Average Mass | 324.330 |
| Monoisotopic Mass | 324.15327 |
| SMILES | NCC(CC[C@H](N)C(=O)O)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24N2O8/c13-3-5(1-2-6(14)11(19)20)21-12-10(18)9(17)8(16)7(4-15)22-12/h5-10,12,15-18H,1-4,13-14H2,(H,19,20)/t5?,6-,7+,8-,9-,10+,12+/m0/s1 |
| InChIKey | OWGKYELXGFKIHH-ODPZDSJBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(β-D-galactosyloxy)-L-lysine (CHEBI:37564) is a 5-glycosyloxy-L-lysine (CHEBI:21994) |
| IUPAC Name |
|---|
| 5-(β-D-galactopyranosyloxy)-L-lysine |
| Registry Numbers | Sources |
|---|---|
| CAS:32448-36-5 | ChemIDplus |