EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO8 |
| Net Charge | 0 |
| Average Mass | 281.261 |
| Monoisotopic Mass | 281.11107 |
| SMILES | C[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H19NO8/c1-3(5(11)9(16)17)18-10-8(15)7(14)6(13)4(2-12)19-10/h3-8,10,12-15H,2,11H2,1H3,(H,16,17)/t3-,4-,5+,6-,7+,8+,10+/m1/s1 |
| InChIKey | DHIKRLNYEAMDOC-RBCVCIGJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(α-D-mannosyl)-L-threonine (CHEBI:37557) is a O-glycosyl-L-threonine (CHEBI:21958) |
| Incoming Relation(s) |
| O-(α-D-mannosyl)-L-threonine residue (CHEBI:137323) is substituent group from O-(α-D-mannosyl)-L-threonine (CHEBI:37557) |
| IUPAC Name |
|---|
| O-(α-D-mannopyranosyl)-L-threonine |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-amino-3-(α-D-mannopyranosyloxy)butanoic acid | IUPAC |
| O-alpha-D-mannopyranosyl-L-threonine | ChemIDplus |
| O-Mannopyranosyl-L-threonine | ChemIDplus |
| O-Mannopyranosylthreonine | ChemIDplus |
| O-Man-thr | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5442330 | Beilstein |
| CAS:78609-12-8 | ChemIDplus |