EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23ClN2.HCl |
| Net Charge | 0 |
| Average Mass | 351.321 |
| Monoisotopic Mass | 350.13165 |
| SMILES | CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc21.Cl |
| InChI | InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
| InChIKey | WIMWMKZEIBHDTH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clomipramine hydrochloride (CHEBI:3755) has part clomipramine(1+) (CHEBI:64209) |
| clomipramine hydrochloride (CHEBI:3755) has role anticoronaviral agent (CHEBI:149553) |
| clomipramine hydrochloride (CHEBI:3755) has role antidepressant (CHEBI:35469) |
| clomipramine hydrochloride (CHEBI:3755) has role serotonergic antagonist (CHEBI:48279) |
| clomipramine hydrochloride (CHEBI:3755) has role serotonergic drug (CHEBI:48278) |
| clomipramine hydrochloride (CHEBI:3755) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride | IUPAC |
| 3-chloroimipramine hydrochloride | ChemIDplus |
| chloroimipramine monohydrochloride | ChemIDplus |
| clomipramine HCl | ChemIDplus |
| clomipramine monohydrochloride | ChEBI |
| Brand Name | Source |
|---|---|
| Anafranil | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4168494 | Reaxys |
| CAS:17321-77-6 | KEGG DRUG |
| CAS:17321-77-6 | ChemIDplus |