EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O7 |
| Net Charge | -2 |
| Average Mass | 178.096 |
| Monoisotopic Mass | 178.01245 |
| SMILES | [H]C(O)([C@@]([H])(O)C(=O)[O-])[C@@]([H])(O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O7/c6-1(2(7)4(9)10)3(8)5(11)12/h1-3,6-8H,(H,9,10)(H,11,12)/p-2/t2-,3-/m1/s1 |
| InChIKey | NPTTZSYLTYJCPR-PWNYCUMCSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arabinarate(2−) (CHEBI:37544) is a arabinarate(2−) (CHEBI:37540) |
| L-arabinarate(2−) (CHEBI:37544) is conjugate base of L-arabinarate(1−) (CHEBI:21225) |
| L-arabinarate(2−) (CHEBI:37544) is enantiomer of D-arabinarate(2−) (CHEBI:37543) |
| Incoming Relation(s) |
| L-arabinarate(1−) (CHEBI:21225) is conjugate acid of L-arabinarate(2−) (CHEBI:37544) |
| D-arabinarate(2−) (CHEBI:37543) is enantiomer of L-arabinarate(2−) (CHEBI:37544) |
| Synonym | Source |
|---|---|
| L-arabinarate | ChEBI |