EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 3H.C26H28ClNO.C6H5O7 |
| Net Charge | 0 |
| Average Mass | 598.092 |
| Monoisotopic Mass | 597.21294 |
| SMILES | CCN(CC)CCOc1ccc(C(=C(Cl)c2ccccc2)c2ccccc2)cc1.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[H+].[H+].[H+] |
| InChI | InChI=1S/C26H28ClNO.C6H8O7/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-18H,3-4,19-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | PYTMYKVIJXPNBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clomiphene citrate (CHEBI:3753) has part clomiphene (CHEBI:3752) |
| clomiphene citrate (CHEBI:3753) has role anti-estrogen (CHEBI:50751) |
| clomiphene citrate (CHEBI:3753) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylethanamine 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Clomifene citrate | KEGG DRUG |
| Clomiphene dihydrogen citrate | ChemIDplus |