EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14ClNO2 |
| Net Charge | 0 |
| Average Mass | 239.702 |
| Monoisotopic Mass | 239.07131 |
| SMILES | CC1(C)CON(Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C12H14ClNO2/c1-12(2)8-16-14(11(12)15)7-9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3 |
| InChIKey | KIEDNEWSYUYDSN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clomazone (CHEBI:3751) has role agrochemical (CHEBI:33286) |
| clomazone (CHEBI:3751) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| clomazone (CHEBI:3751) has role environmental contaminant (CHEBI:78298) |
| clomazone (CHEBI:3751) has role herbicide (CHEBI:24527) |
| clomazone (CHEBI:3751) has role xenobiotic (CHEBI:35703) |
| clomazone (CHEBI:3751) is a isoxazolidinone (CHEBI:55375) |
| clomazone (CHEBI:3751) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-(2-chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one |
| Synonyms | Source |
|---|---|
| Dimethazone | NIST Chemistry WebBook |
| FMC57020 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7480026 | Reaxys |
| CAS:81777-89-1 | NIST Chemistry WebBook |
| CAS:81777-89-1 | KEGG COMPOUND |
| Citations |
|---|