EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O3 |
| Net Charge | 0 |
| Average Mass | 226.231 |
| Monoisotopic Mass | 226.06299 |
| SMILES | Oc1ccc2c(O)c3ccccc3cc2c1O |
| InChI | InChI=1S/C14H10O3/c15-12-6-5-10-11(14(12)17)7-8-3-1-2-4-9(8)13(10)16/h1-7,15-17H |
| InChIKey | TZIQWQARHPGHIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthrarobin (CHEBI:37504) has role allergen (CHEBI:50904) |
| anthrarobin (CHEBI:37504) is a anthracenetriol (CHEBI:37505) |
| IUPAC Name |
|---|
| anthracene-1,2,10-triol |
| Synonyms | Source |
|---|---|
| anthrarobin | ChemIDplus |
| 1,2,10-anthratriol | ChemIDplus |
| 3,4,9-trihydroxyanthracene | ChemIDplus |
| 3,4-dihydroxyanthranol | ChemIDplus |
| 1,2,10-trihydroxyanthracene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3531675 | Beilstein |
| CAS:577-33-3 | ChemIDplus |
| Citations |
|---|