EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O8 |
| Net Charge | 0 |
| Average Mass | 304.210 |
| Monoisotopic Mass | 304.02192 |
| SMILES | O=C1c2c(O)cc(O)c(O)c2C(=O)c2c(O)cc(O)c(O)c21 |
| InChI | InChI=1S/C14H8O8/c15-3-1-5(17)11(19)9-7(3)13(21)10-8(14(9)22)4(16)2-6(18)12(10)20/h1-2,15-20H |
| InChIKey | MMRNCQMFQXTUGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthracene blue SWR (CHEBI:37498) has role histological dye (CHEBI:77178) |
| anthracene blue SWR (CHEBI:37498) is a hexahydroxyanthraquinone (CHEBI:37499) |
| IUPAC Name |
|---|
| 1,2,4,5,6,8-hexahydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,2,4,5,6,8-hexahydroxy-9,10-anthraquinone | IUPAC |
| 1,2,4,5,6,8-hexahydroxyanthraquinone | ChEBI |
| alizarin blue 2RC | ChEBI |
| C.I. 58605 | ChEBI |
| mordant blue 32 | ChEBI |