EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O6 |
| Net Charge | 0 |
| Average Mass | 272.212 |
| Monoisotopic Mass | 272.03209 |
| SMILES | O=C1c2ccc(O)c(O)c2C(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C14H8O6/c15-6-3-4-7(16)11-10(6)12(18)5-1-2-8(17)13(19)9(5)14(11)20/h1-4,15-17,19H |
| InChIKey | VBHKTXLEJZIDJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinalizarin (CHEBI:37495) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| quinalizarin (CHEBI:37495) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| IUPAC Name |
|---|
| 1,2,5,8-tetrahydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,2,5,8-tetrahydroxy-9,10-anthracenedione | ChemIDplus |
| 1,2,5,8-tetrahydroxy-9,10-anthraquinone | IUPAC |
| 1,2,5,8-tetrahydroxyanthra-9,10-quinone | NIST Chemistry WebBook |
| 1,2,5,8-tetrahydroxyanthraquinone | ChemIDplus |
| 1,4,5,6-tetrahydroxyanthraquinone | NIST Chemistry WebBook |
| Alizarinbordeaux | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| DB08660 | DrugBank |
| Quinalizarin | Wikipedia |
| Citations |
|---|