EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O[C@@H]1C=Cc2c(ccc3ccccc23)[C@H]1O |
| InChI | InChI=1S/C14H12O2/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16/h1-8,13-16H/t13-,14-/m1/s1 |
| InChIKey | FZOALBNXOKAOEW-ZIAGYGMSSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2R)-1,2-dihydrophenanthrene-1,2-diol (CHEBI:37473) is a trans-1,2-dihydrophenanthrene-1,2-diol (CHEBI:27038) |
| (1R,2R)-1,2-dihydrophenanthrene-1,2-diol (CHEBI:37473) is enantiomer of (1S,2S)-1,2-dihydrophenanthrene-1,2-diol (CHEBI:37472) |
| Incoming Relation(s) |
| (1S,2S)-1,2-dihydrophenanthrene-1,2-diol (CHEBI:37472) is enantiomer of (1R,2R)-1,2-dihydrophenanthrene-1,2-diol (CHEBI:37473) |
| IUPAC Name |
|---|
| (1R,2R)-1,2-dihydrophenanthrene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3133379 | Beilstein |