EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O4S |
| Net Charge | 0 |
| Average Mass | 274.297 |
| Monoisotopic Mass | 274.02998 |
| SMILES | O=S(=O)(O)Oc1cccc2ccc3ccccc3c12 |
| InChI | InChI=1S/C14H10O4S/c15-19(16,17)18-13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9H,(H,15,16,17) |
| InChIKey | NGHHMZVUHHGUQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phenanthryl hydrogen sulfate (CHEBI:37460) is a phenanthryl hydrogen sulfate (CHEBI:37457) |
| 4-phenanthryl hydrogen sulfate (CHEBI:37460) is conjugate acid of 4-phenanthryl sulfate (CHEBI:20470) |
| Incoming Relation(s) |
| 4-phenanthryl sulfate (CHEBI:20470) is conjugate base of 4-phenanthryl hydrogen sulfate (CHEBI:37460) |
| IUPAC Names |
|---|
| 4-phenanthryl hydrogen sulfate |
| phenanthren-4-yl hydrogen sulfate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2537431 | Beilstein |