EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O2 |
| Net Charge | 0 |
| Average Mass | 208.216 |
| Monoisotopic Mass | 208.05243 |
| SMILES | O=C1C(=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H8O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8H |
| InChIKey | YYVYAPXYZVYDHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-phenanthroquinone (CHEBI:37454) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| phenanthrene-9,10-dione |
| Synonyms | Source |
|---|---|
| 9,10-Phenanthrenedione | KEGG COMPOUND |
| 9,10-phenanthrenequinone | UM-BBD |
| 9,10-Phenanthroquinone | KEGG COMPOUND |
| Phenanthraquinone | KEGG COMPOUND |
| Phenanthrenequinone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 9,10-phenanthroquinone | UniProt |