EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O9 |
| Net Charge | 0 |
| Average Mass | 476.522 |
| Monoisotopic Mass | 476.20463 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3cc(OC)c(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C25H32O9/c1-25-8-7-12-13(15(25)5-6-18(25)26)4-3-11-9-17(16(32-2)10-14(11)12)33-24-21(29)19(27)20(28)22(34-24)23(30)31/h9-10,12-13,15,19-22,24,27-29H,3-8H2,1-2H3,(H,30,31)/t12-,13+,15-,19-,20-,21+,22-,24+,25-/m0/s1 |
| InChIKey | NZTHZDNDYACBSX-FJNWEKAQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) has functional parent 2-methoxyestrone (CHEBI:1189) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) has role mouse metabolite (CHEBI:75771) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) is a 17-oxo steroid (CHEBI:19168) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) is a aromatic ether (CHEBI:35618) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) is a steroid glucosiduronic acid (CHEBI:26763) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) is conjugate acid of 2-methoxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136971) |
| Incoming Relation(s) |
| 2-methoxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136971) is conjugate base of 2-methoxyestrone 3-O-(β-D-glucuronide) (CHEBI:37450) |
| IUPAC Name |
|---|
| 2-methoxy-17-oxoestra-1(10),2,4-trien-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 2-Methoxyestrone 3-glucuronide | KEGG COMPOUND |
| 2-methoxyestrone 3-glucuronoside | ChEBI |
| 2-Methoxyestrone-3-glucuronide | ChemIDplus |
| 2-MeOE1 3G | ChEBI |
| 2-methoxyestrone 3-glucosiduronic acid | ChEBI |
| 2-methoxyestrone 3-β-glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11132 | KEGG COMPOUND |
| LMST05010010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11305842 | Reaxys |
| CAS:25577-70-2 | KEGG COMPOUND |
| CAS:25577-70-2 | ChemIDplus |