EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O5 |
| Net Charge | 0 |
| Average Mass | 160.125 |
| Monoisotopic Mass | 160.03717 |
| SMILES | O=C(O)CCC(=O)CC(=O)O |
| InChI | InChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11) |
| InChIKey | RTGHRDFWYQHVFW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxoadipic acid (CHEBI:37440) has functional parent adipic acid (CHEBI:30832) |
| 3-oxoadipic acid (CHEBI:37440) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 3-oxoadipic acid (CHEBI:37440) has role human metabolite (CHEBI:77746) |
| 3-oxoadipic acid (CHEBI:37440) is a dicarboxylic fatty acid (CHEBI:189840) |
| 3-oxoadipic acid (CHEBI:37440) is a oxo dicarboxylic acid (CHEBI:36145) |
| 3-oxoadipic acid (CHEBI:37440) is conjugate acid of 3-oxoadipate(2−) (CHEBI:15775) |
| Incoming Relation(s) |
| 3-oxoadipyl-CoA (CHEBI:15490) has functional parent 3-oxoadipic acid (CHEBI:37440) |
| 3-oxoadipate(2−) (CHEBI:15775) is conjugate base of 3-oxoadipic acid (CHEBI:37440) |
| IUPAC Name |
|---|
| 3-oxohexanedioic acid |
| Synonyms | Source |
|---|---|
| 3-Keto-adipate | KEGG COMPOUND |
| 3-Oxoadipic acid | KEGG COMPOUND |
| beta-Ketoadipic acid | ChemIDplus |
| beta-Oxoadipic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00846 | KEGG COMPOUND |
| HMDB0000398 | HMDB |
| LMFA01170096 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1775833 | Reaxys |
| CAS:689-31-6 | KEGG COMPOUND |
| CAS:689-31-6 | ChemIDplus |
| Citations |
|---|