EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H54N10O14S |
| Net Charge | 0 |
| Average Mass | 918.984 |
| Monoisotopic Mass | 918.35417 |
| SMILES | [H][C@@]12C[C@@H](O)CN1C(=O)[C@H](CC(N)=O)NC(=O)[C@]1([H])C[S@@](=O)c3nc4cc(O)ccc4c3C[C@]([H])(NC(=O)[C@]([H])([C@@H](C)[C@@H](O)CO)NC2=O)C(=O)NCC(=O)N[C@@]([H])([C@@H](C)CC)C(=O)NCC(=O)N1 |
| InChI | InChI=1S/C39H54N10O14S/c1-4-16(2)31-36(60)42-11-29(55)43-25-15-64(63)38-21(20-6-5-18(51)7-22(20)46-38)9-23(33(57)41-12-30(56)47-31)44-37(61)32(17(3)27(53)14-50)48-35(59)26-8-19(52)13-49(26)39(62)24(10-28(40)54)45-34(25)58/h5-7,16-17,19,23-27,31-32,46,50-53H,4,8-15H2,1-3H3,(H2,40,54)(H,41,57)(H,42,60)(H,43,55)(H,44,61)(H,45,58)(H,47,56)(H,48,59)/t16-,17-,19+,23-,24-,25-,26-,27-,31-,32-,64+/m0/s1 |
| InChIKey | CIORWBWIBBPXCG-SXZCQOKQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-amanitin (CHEBI:37415) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| α-amanitin (CHEBI:37415) has role mycotoxin (CHEBI:25442) |
| α-amanitin (CHEBI:37415) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| 1,8-anhydro-S1,C2.5-cyclo[L-cysteinyl-L-asparaginyl-trans-4-hydroxy-L-prolyl-(R)-4,5-dihydroxy-L-isoleucyl-6-hydroxy-L-tryptophylglycyl-L-isoleucylglycine] (R)-S1-oxide |
| Synonyms | Source |
|---|---|
| alpha-Amanitin | KEGG COMPOUND |
| alpha-Amanitine | ChemIDplus |
| alpha-Amatoxin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08438 | KEGG COMPOUND |
| Alpha-amanitin | Wikipedia |
| C00001516 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1071138 | Reaxys |
| CAS:23109-05-9 | KEGG COMPOUND |
| CAS:23109-05-9 | ChemIDplus |
| Citations |
|---|