EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O8 |
| Net Charge | 0 |
| Average Mass | 386.356 |
| Monoisotopic Mass | 386.10017 |
| SMILES | [H][C@]1(c2ccc(O)c(OC)c2)Oc2c(OC)cc3ccc(=O)oc3c2O[C@@H]1CO |
| InChI | InChI=1S/C20H18O8/c1-24-13-7-10(3-5-12(13)22)17-15(9-21)26-20-18-11(4-6-16(23)27-18)8-14(25-2)19(20)28-17/h3-8,15,17,21-22H,9H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | OCBGWPJNUZMLCA-NVXWUHKLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cleomiscosin A (CHEBI:3740) has role anti-inflammatory agent (CHEBI:67079) |
| cleomiscosin A (CHEBI:3740) has role metabolite (CHEBI:25212) |
| cleomiscosin A (CHEBI:3740) is a aromatic ether (CHEBI:35618) |
| cleomiscosin A (CHEBI:3740) is a organic heterotricyclic compound (CHEBI:26979) |
| cleomiscosin A (CHEBI:3740) is a phenols (CHEBI:33853) |
| cleomiscosin A (CHEBI:3740) is a primary alcohol (CHEBI:15734) |
| cleomiscosin A (CHEBI:3740) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-9H-[1,4]dioxino[2,3-h]chromen-9-one |
| Synonym | Source |
|---|---|
| Cleomiscosin A | KEGG COMPOUND |
| Citations |
|---|