EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO5 |
| Net Charge | 0 |
| Average Mass | 199.162 |
| Monoisotopic Mass | 199.04807 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)O)/C(=C/CO)O2 |
| InChI | InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1-/t6-,7-/m1/s1 |
| InChIKey | HZZVJAQRINQKSD-PBFISZAISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces clavuligerus (ncbitaxon:1901) | - | PubMed (18450406) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiviral agent A substance that destroys or inhibits replication of viruses. antibacterial drug A drug used to treat or prevent bacterial infections. anti-obesity agent Any substance which is used to reduce or control weight. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antibacterial drug A drug used to treat or prevent bacterial infections. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-asthmatic agent Any compound that has anti-asthmatic effects. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clavulanic acid (CHEBI:48947) has role anti-asthmatic agent (CHEBI:65023) |
| clavulanic acid (CHEBI:48947) has role anti-obesity agent (CHEBI:74518) |
| clavulanic acid (CHEBI:48947) has role anti-ulcer drug (CHEBI:49201) |
| clavulanic acid (CHEBI:48947) has role antibacterial agent (CHEBI:33282) |
| clavulanic acid (CHEBI:48947) has role antibacterial drug (CHEBI:36047) |
| clavulanic acid (CHEBI:48947) has role antidepressant (CHEBI:35469) |
| clavulanic acid (CHEBI:48947) has role antiinfective agent (CHEBI:35441) |
| clavulanic acid (CHEBI:48947) has role antimicrobial agent (CHEBI:33281) |
| clavulanic acid (CHEBI:48947) has role antineoplastic agent (CHEBI:35610) |
| clavulanic acid (CHEBI:48947) has role antitubercular agent (CHEBI:33231) |
| clavulanic acid (CHEBI:48947) has role antiviral agent (CHEBI:22587) |
| clavulanic acid (CHEBI:48947) has role anxiolytic drug (CHEBI:35474) |
| clavulanic acid (CHEBI:48947) has role bacterial metabolite (CHEBI:76969) |
| clavulanic acid (CHEBI:48947) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| clavulanic acid (CHEBI:48947) has role vasodilator agent (CHEBI:35620) |
| clavulanic acid (CHEBI:48947) is a oxapenam (CHEBI:64509) |
| clavulanic acid (CHEBI:48947) is conjugate acid of clavulanate (CHEBI:487869) |
| Incoming Relation(s) |
| clavulanate (CHEBI:487869) is conjugate base of clavulanic acid (CHEBI:48947) |
| IUPAC Name |
|---|
| (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| INNs | Source |
|---|---|
| acide clavulanique | ChemIDplus |
| ácido clavulánico | ChemIDplus |
| acidum clavulanicum | ChemIDplus |
| clavulanic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2R,3Z,5R)-3-(2-HYDROXYETHYLIDENE)-7-OXO-4-OXA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID | PDBeChem |
| antibiotic MM 14151 | ChemIDplus |
| BRL 14151 | ChEMBL |
| BRL-14151 | ChEMBL |
| Clavulanate | KEGG COMPOUND |
| Clavulanic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1930 | VSDB |
| 669 | DrugCentral |
| C00018091 | KNApSAcK |
| C06662 | KEGG COMPOUND |
| Clavulanic_Acid | Wikipedia |
| D07711 | KEGG DRUG |
| DB00766 | DrugBank |
| DE2517316 | Patent |
| HMDB0014904 | HMDB |
| J01 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:787059 | Reaxys |
| Beilstein:787059 | Beilstein |
| CAS:58001-44-8 | KEGG COMPOUND |
| CAS:58001-44-8 | DrugBank |
| CAS:58001-44-8 | ChemIDplus |
| Citations |
|---|