EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H69NO13 |
| Net Charge | 0 |
| Average Mass | 747.964 |
| Monoisotopic Mass | 747.47689 |
| SMILES | [H][C@]1(O[C@H]2[C@H](C)[C@@H](O[C@]3([H])O[C@H](C)C[C@H](N(C)C)[C@H]3O)[C@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]2C)C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C38H69NO13/c1-15-26-38(10,45)31(42)21(4)28(40)19(2)17-37(9,47-14)33(52-35-29(41)25(39(11)12)16-20(3)48-35)22(5)30(23(6)34(44)50-26)51-27-18-36(8,46-13)32(43)24(7)49-27/h19-27,29-33,35,41-43,45H,15-18H2,1-14H3/t19-,20-,21+,22+,23-,24+,25+,26-,27+,29-,30+,31-,32+,33-,35+,36-,37-,38-/m1/s1 |
| InChIKey | AGOYDEPGAOXOCK-KCBOHYOISA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clarithromycin (CHEBI:3732) has role antibacterial drug (CHEBI:36047) |
| clarithromycin (CHEBI:3732) has role environmental contaminant (CHEBI:78298) |
| clarithromycin (CHEBI:3732) has role protein synthesis inhibitor (CHEBI:48001) |
| clarithromycin (CHEBI:3732) has role xenobiotic (CHEBI:35703) |
| clarithromycin (CHEBI:3732) is a macrolide antibiotic (CHEBI:25105) |
| IUPAC Name |
|---|
| O6-methylerythromycin |
| INNs | Source |
|---|---|
| clarithromycin | ChemIDplus |
| clarithromycina | ChemIDplus |
| clarithromycine | ChemIDplus |
| clarithromycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-O-methylerythromycin | ChemIDplus |
| 6-O-methylerythromycin A | ChemIDplus |
| CLA | DrugBank |
| Clarithromycin | KEGG COMPOUND |
| CLARITHROMYCIN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3581974 | Reaxys |
| CAS:81103-11-9 | ChemIDplus |
| CAS:81103-11-9 | KEGG COMPOUND |
| Citations |
|---|