EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48N7O17P3S |
| Net Charge | 0 |
| Average Mass | 879.713 |
| Monoisotopic Mass | 879.20402 |
| SMILES | CCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C28H48N7O17P3S/c1-4-5-6-7-8-19(37)56-12-11-30-18(36)9-10-31-26(40)23(39)28(2,3)14-49-55(46,47)52-54(44,45)48-13-17-22(51-53(41,42)43)21(38)27(50-17)35-16-34-20-24(29)32-15-33-25(20)35/h15-17,21-23,27,38-39H,4-14H2,1-3H3,(H,30,36)(H,31,40)(H,44,45)(H,46,47)(H2,29,32,33)(H2,41,42,43)/t17-,21-,22-,23+,27-/m1/s1 |
| InChIKey | CHVYGJMBUXUTSX-SVHODSNWSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptanoyl-CoA (CHEBI:37283) has functional parent coenzyme A (CHEBI:15346) |
| heptanoyl-CoA (CHEBI:37283) has functional parent heptanoic acid (CHEBI:45571) |
| heptanoyl-CoA (CHEBI:37283) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| heptanoyl-CoA (CHEBI:37283) is a saturated fatty acyl-CoA (CHEBI:231546) |
| heptanoyl-CoA (CHEBI:37283) is conjugate acid of heptanoyl-CoA(4−) (CHEBI:78811) |
| Incoming Relation(s) |
| (3R)-3-isopropenyl-6-oxoheptanoyl-CoA (CHEBI:29004) has functional parent heptanoyl-CoA (CHEBI:37283) |
| (3S)-3-isopropenyl-6-oxoheptanoyl-CoA (CHEBI:212) has functional parent heptanoyl-CoA (CHEBI:37283) |
| heptanoyl-CoA(4−) (CHEBI:78811) is conjugate base of heptanoyl-CoA (CHEBI:37283) |
| Synonyms | Source |
|---|---|
| 3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-4-[(3-{[2-(heptanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-2,2-dimethyl-4-oxobutyl} dihydrogen diphosphate) | ChEBI |
| heptanoyl-CoA | ChEBI |
| C7:0-CoA | ChEBI |
| enanthyl-coenzyme A | ChEBI |
| enanthyl-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012969 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9607758 | Reaxys |
| Citations |
|---|