EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O3 |
| Net Charge | 0 |
| Average Mass | 242.359 |
| Monoisotopic Mass | 242.18819 |
| SMILES | CCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14(16)17/h2-12H2,1H3,(H,16,17) |
| InChIKey | XLKOZYOVXNPWGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxotetradecanoic acid (CHEBI:37270) has functional parent tetradecanoic acid (CHEBI:28875) |
| 3-oxotetradecanoic acid (CHEBI:37270) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxotetradecanoic acid (CHEBI:37270) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| 3-oxotetradecanoyl-CoA (CHEBI:28726) has functional parent 3-oxotetradecanoic acid (CHEBI:37270) |
| IUPAC Name |
|---|
| 3-oxotetradecanoic acid |
| Synonym | Source |
|---|---|
| 3-oxomyristic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060099 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1782877 | Beilstein |