EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O4 |
| Net Charge | 0 |
| Average Mass | 158.153 |
| Monoisotopic Mass | 158.05791 |
| SMILES | [H]C(=CC(=O)O)CCCC(=O)O |
| InChI | InChI=1S/C7H10O4/c8-6(9)4-2-1-3-5-7(10)11/h2,4H,1,3,5H2,(H,8,9)(H,10,11) |
| InChIKey | OXQWBLJQOBXJPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hept-2-enedioic acid (CHEBI:37260) is a heptenedioic acid (CHEBI:24522) |
| Incoming Relation(s) |
| 2,3-didehydropimeloyl-CoA (CHEBI:15503) has functional parent hept-2-enedioic acid (CHEBI:37260) |
| IUPAC Name |
|---|
| hept-2-enedioic acid |
| Synonym | Source |
|---|---|
| 2,3-didehydropimelic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1766602 | Beilstein |