EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O5 |
| Net Charge | 0 |
| Average Mass | 174.152 |
| Monoisotopic Mass | 174.05282 |
| SMILES | O=C(O)CCCC(=O)CC(=O)O |
| InChI | InChI=1S/C7H10O5/c8-5(4-7(11)12)2-1-3-6(9)10/h1-4H2,(H,9,10)(H,11,12) |
| InChIKey | IYNRULSFFKEOLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxopimelic acid (CHEBI:37259) has functional parent pimelic acid (CHEBI:30531) |
| 3-oxopimelic acid (CHEBI:37259) is a oxo dicarboxylic acid (CHEBI:36145) |
| Incoming Relation(s) |
| 3-oxopimeloyl-CoA (CHEBI:15492) has functional parent 3-oxopimelic acid (CHEBI:37259) |
| IUPAC Name |
|---|
| 3-oxoheptanedioic acid |
| Synonym | Source |
|---|---|
| 3-Ketoheptanedioic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1777790 | Reaxys |
| CAS:1608-78-2 | ChemIDplus |