EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)O |
| InChI | InChI=1S/C20H40O3/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(21)20(22)23/h15-19,21H,6-14H2,1-5H3,(H,22,23) |
| InChIKey | CGKMKXBKVBXUGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyphytanic acid (CHEBI:37258) has functional parent phytanic acid (CHEBI:16285) |
| 2-hydroxyphytanic acid (CHEBI:37258) is a 2-hydroxy fatty acid (CHEBI:10283) |
| Incoming Relation(s) |
| 2-hydroxyphytanoyl-CoA (CHEBI:15475) has functional parent 2-hydroxyphytanic acid (CHEBI:37258) |
| IUPAC Name |
|---|
| 2-hydroxy-3,7,11,15-tetramethylhexadecanoic acid |
| Synonyms | Source |
|---|---|
| alpha-Hydroxyphytanic acid | ChemIDplus |
| α-hydroxyphytanic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:14721-68-7 | ChemIDplus |
| Citations |
|---|