EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | CCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C16H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19/h2-14H2,1H3,(H,18,19) |
| InChIKey | ASICPMTWQSESKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxopalmitic acid (CHEBI:37251) has functional parent hexadecanoic acid (CHEBI:15756) |
| 3-oxopalmitic acid (CHEBI:37251) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxopalmitic acid (CHEBI:37251) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| (R)-3-oxopalmitoylcarnitine (CHEBI:84655) has functional parent 3-oxopalmitic acid (CHEBI:37251) |
| 3-oxopalmitoyl-CoA (CHEBI:15491) has functional parent 3-oxopalmitic acid (CHEBI:37251) |
| 3-oxopalmitoyl group (CHEBI:62816) is substituent group from 3-oxopalmitic acid (CHEBI:37251) |
| IUPAC Name |
|---|
| 3-oxohexadecanoic acid |
| Synonym | Source |
|---|---|
| 3-keto palmitic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060051 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1787844 | Beilstein |