EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCCCCCCCCCCCC[C@H](O)CC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | CBWALJHXHCJYTE-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxypalmitic acid (CHEBI:37250) is a 3-hydroxypalmitic acid (CHEBI:37248) |
| (S)-3-hydroxypalmitic acid (CHEBI:37250) is enantiomer of (R)-3-hydroxypalmitic acid (CHEBI:38247) |
| Incoming Relation(s) |
| (S)-3-hydroxypalmitoyl-CoA (CHEBI:27402) has functional parent (S)-3-hydroxypalmitic acid (CHEBI:37250) |
| methyl (S)-3-hydroxypalmitate (CHEBI:38246) has functional parent (S)-3-hydroxypalmitic acid (CHEBI:37250) |
| (R)-3-hydroxypalmitic acid (CHEBI:38247) is enantiomer of (S)-3-hydroxypalmitic acid (CHEBI:37250) |
| IUPAC Name |
|---|
| (3S)-3-hydroxyhexadecanoic acid |
| Synonym | Source |
|---|---|
| (S)-β-hydroxypalmitic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6478240 | Beilstein |