EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | CCCCCCCC/C=C\CC(=O)O |
| InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h9-10H,2-8,11H2,1H3,(H,13,14)/b10-9- |
| InChIKey | XZJZNZATFHOMSJ-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3-dodecenoic acid (CHEBI:37207) is a 3-dodecenoic acid (CHEBI:38373) |
| Incoming Relation(s) |
| cis-dodec-3-enoyl-CoA (CHEBI:27989) has functional parent cis-3-dodecenoic acid (CHEBI:37207) |
| IUPAC Name |
|---|
| (3Z)-dodec-3-enoic acid |
| Synonyms | Source |
|---|---|
| 12:1, n-9 cis | ChEBI |
| 3-cis-Dodecen-carbonsäure | ChEBI |
| C12:1, n-9 cis | ChEBI |
| Dodecen-(3)-säure | ChEBI |
| cis-dodec-3-enoic acid | ChEBI |
| (Z)-3-dodecenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2325564 | Reaxys |
| Citations |
|---|