EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29ClFN3O4 |
| Net Charge | 0 |
| Average Mass | 465.953 |
| Monoisotopic Mass | 465.18306 |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCCOc2ccc(F)cc2)C[C@@H]1OC |
| InChI | InChI=1S/C23H29ClFN3O4/c1-30-21-13-19(26)18(24)12-17(21)23(29)27-20-8-10-28(14-22(20)31-2)9-3-11-32-16-6-4-15(25)5-7-16/h4-7,12-13,20,22H,3,8-11,14,26H2,1-2H3,(H,27,29)/t20-,22+/m1/s1 |
| InChIKey | DCSUBABJRXZOMT-IRLDBZIGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cisapride (CHEBI:3720) has role anti-ulcer drug (CHEBI:49201) |
| cisapride (CHEBI:3720) has role gastrointestinal drug (CHEBI:55324) |
| cisapride (CHEBI:3720) has role serotonergic agonist (CHEBI:35941) |
| cisapride (CHEBI:3720) is a aromatic ether (CHEBI:35618) |
| cisapride (CHEBI:3720) is a benzamides (CHEBI:22702) |
| cisapride (CHEBI:3720) is a monochlorobenzenes (CHEBI:83403) |
| cisapride (CHEBI:3720) is a organofluorine compound (CHEBI:37143) |
| cisapride (CHEBI:3720) is a piperidines (CHEBI:26151) |
| cisapride (CHEBI:3720) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-amino-5-chloro-N-{cis-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl}-2-methoxybenzamide |
| INNs | Source |
|---|---|
| cisapridum | ChemIDplus |
| cisapride | ChemIDplus |
| cisaprida | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cisapride | KEGG COMPOUND |
| 4-amino-5-chloro-N-(1-(3-(4-fluorophenoxy)propyl)-3-methoxypiperidin-4-yl)-2-methoxybenzamide | ChEMBL |
| 4-Amino-5-chloro-N-{1-[3-(4-fluoro-phenoxy)-propyl]-3-methoxy-piperidin-4-yl}-2-methoxy-benzamide | ChEMBL |
| (±)-cisapride | ChemIDplus |
| cis-4-amino-5-chloro-N-(1-(3-(p-fluorophenoxy)propyl)-3-methoxy-4-piperidyl)-o-anisamide | ChemIDplus |
| cis-4-amino-5-chloro-N-{1-[3-(p-fluorophenoxy)propyl]-3-methoxy-4-piperidinyl}-o-anisamide | ChEBI |
| Citations |
|---|