EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1OC |
| InChI | InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3 |
| InChIKey | IMEYGBIXGJLUIS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia chinensis (ncbitaxon:99046) | leaf (BTO:0000713) | PubMed (24689280) | |
| Phyla nodiflora (ncbitaxon:222877) | aerial part (BTO:0001658) | PubMed (25140335) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cirsiliol (CHEBI:3719) has functional parent flavone (CHEBI:42491) |
| cirsiliol (CHEBI:3719) has role plant metabolite (CHEBI:76924) |
| cirsiliol (CHEBI:3719) is a dimethoxyflavone (CHEBI:23798) |
| cirsiliol (CHEBI:3719) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5-trihydroxy-6,7-dimethoxyflavone | ChemIDplus |
| 6,7-dimethoxy-5,3',4'-trihydroxyflavone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cirsiliol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001033 | KNApSAcK |
| C10033 | KEGG COMPOUND |
| LMPK12111227 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1354524 | Reaxys |
| CAS:34334-69-5 | KEGG COMPOUND |
| CAS:34334-69-5 | ChemIDplus |
| Citations |
|---|