EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)ccc1O |
| InChI | InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| InChIKey | VKOSQMWSWLZQPA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia chinensis (ncbitaxon:99046) | leaf (BTO:0000713) | PubMed (24689280) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cirsilineol (CHEBI:3718) has functional parent flavone (CHEBI:42491) |
| cirsilineol (CHEBI:3718) has role antineoplastic agent (CHEBI:35610) |
| cirsilineol (CHEBI:3718) has role plant metabolite (CHEBI:76924) |
| cirsilineol (CHEBI:3718) is a dihydroxyflavone (CHEBI:38686) |
| cirsilineol (CHEBI:3718) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C10032 | KEGG COMPOUND |
| C00013595 | KNApSAcK |
| LMPK12111249 | LIPID MAPS |
| Cirsilineol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1355108 | Reaxys |
| CAS:41365-32-6 | KEGG COMPOUND |
| CAS:41365-32-6 | ChemIDplus |
| Citations |
|---|