EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O5 |
| Net Charge | -2 |
| Average Mass | 156.093 |
| Monoisotopic Mass | 156.00697 |
| SMILES | O=C([O-])/C=C/C(=O)CC(=O)[O-] |
| InChI | InChI=1S/C6H6O5/c7-4(3-6(10)11)1-2-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1+ |
| InChIKey | SOXXPQLIZIPMIZ-OWOJBTEDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumarylacetate (CHEBI:37161) is a 4-oxohex-2-enedioate (CHEBI:12040) |
| fumarylacetate (CHEBI:37161) is conjugate base of fumarylacetic acid (CHEBI:37160) |
| Incoming Relation(s) |
| fumarylacetic acid (CHEBI:37160) is conjugate acid of fumarylacetate (CHEBI:37161) |
| IUPAC Name |
|---|
| (2E)-4-oxohex-2-enedioate |