EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3716 - cinoxacin
| Formula | C12H10N2O5 |
| Net Charge | 0 |
| Average Mass | 262.221 |
| Monoisotopic Mass | 262.05897 |
| SMILES | CCn1nc(C(=O)O)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C12H10N2O5/c1-2-14-7-4-9-8(18-5-19-9)3-6(7)11(15)10(13-14)12(16)17/h3-4H,2,5H2,1H3,(H,16,17) |
| InChIKey | VDUWPHTZYNWKRN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinoxacin (CHEBI:3716) has role antibacterial drug (CHEBI:36047) |
| cinoxacin (CHEBI:3716) has role antiinfective agent (CHEBI:35441) |
| cinoxacin (CHEBI:3716) is a cinnolines (CHEBI:38770) |
| cinoxacin (CHEBI:3716) is a oxacycle (CHEBI:38104) |
| cinoxacin (CHEBI:3716) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 1-ethyl-4-oxo-1,4-dihydro[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| cinoxacino | ChemIDplus |
| cinoxacin | ChemIDplus |
| cinoxacinum | ChemIDplus |
| cinoxacine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Ethyl-8-oxo-5,8-dihydro-1,3-dioxa-5,6-diaza-cyclopenta[b]naphthalene-7-carboxylic acid | ChEMBL |
| 1-ethyl-6,7-methylenedioxy-4(1H)-oxocinnoline-3-carboxylic acid | ChemIDplus |
| Citations |
|---|