EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | C1=C[C@H]2O[C@H]2c2c1ccc1ccccc21 |
| InChI | InChI=1S/C14H10O/c1-2-4-11-9(3-1)5-6-10-7-8-12-14(15-12)13(10)11/h1-8,12,14H/t12-,14-/m1/s1 |
| InChIKey | SHJAOFFXDWCMOC-TZMCWYRMSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S)-3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:37101) is a 3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:25955) |
| (3R,4S)-3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:37101) is enantiomer of (3S,4R)-3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:37103) |
| Incoming Relation(s) |
| (3S,4R)-3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:37103) is enantiomer of (3R,4S)-3,4-epoxy-3,4-dihydrophenanthrene (CHEBI:37101) |
| IUPAC Name |
|---|
| (1aR,9cS)-1a,9c-dihydrophenanthro[3,4-b]oxirene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1426466 | Beilstein |