EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O3 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 160.10994 |
| SMILES | CCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C8H16O3/c1-2-3-4-5-7(9)6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | NDPLAKGOSZHTPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyoctanoic acid (CHEBI:37098) has functional parent octanoic acid (CHEBI:28837) |
| 3-hydroxyoctanoic acid (CHEBI:37098) is a 3-hydroxy fatty acid (CHEBI:59845) |
| 3-hydroxyoctanoic acid (CHEBI:37098) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxyoctanoic acid (CHEBI:37098) is a medium-chain fatty acid (CHEBI:59554) |
| 3-hydroxyoctanoic acid (CHEBI:37098) is conjugate acid of 3-hydroxyoctanoate (CHEBI:133511) |
| Incoming Relation(s) |
| 3-hydroxyoctanoyl-CoA (CHEBI:86321) has functional parent 3-hydroxyoctanoic acid (CHEBI:37098) |
| (R)-3-hydroxyoctanoic acid (CHEBI:37099) is a 3-hydroxyoctanoic acid (CHEBI:37098) |
| (S)-3-hydroxyoctanoic acid (CHEBI:37100) is a 3-hydroxyoctanoic acid (CHEBI:37098) |
| 3-hydroxyoctanoate (CHEBI:133511) is conjugate base of 3-hydroxyoctanoic acid (CHEBI:37098) |
| IUPAC Name |
|---|
| 3-hydroxyoctanoic acid |
| Synonyms | Source |
|---|---|
| 3HO | ChEBI |
| 3-hydroxycaprylic acid | ChEBI |
| 3-hydroxy-octanoic acid | ChEBI |
| 3-OH-caprylic acid | ChEBI |
| 3-OH octanoic acid | ChEBI |
| β-hydroxycaprylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050021 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1760767 | Beilstein |
| CAS:14292-27-4 | ChemIDplus |
| Citations |
|---|