EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C5H8O3/c1-3(4(2)6)5(7)8/h3H,1-2H3,(H,7,8) |
| InChIKey | GCXJINGJZAOJHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylacetoacetic acid (CHEBI:37079) has functional parent acetoacetic acid (CHEBI:15344) |
| 2-methylacetoacetic acid (CHEBI:37079) has functional parent butyric acid (CHEBI:30772) |
| 2-methylacetoacetic acid (CHEBI:37079) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 2-methylacetoacetic acid (CHEBI:37079) is conjugate acid of 2-methylacetoacetate (CHEBI:19680) |
| Incoming Relation(s) |
| benzyl 2-methyl-3-oxobutanoate (CHEBI:16079) has functional parent 2-methylacetoacetic acid (CHEBI:37079) |
| 2-methylacetoacetate (CHEBI:19680) is conjugate base of 2-methylacetoacetic acid (CHEBI:37079) |
| IUPAC Name |
|---|
| 2-methyl-3-oxobutanoic acid |
| Synonym | Source |
|---|---|
| 2-Methyl-3-oxo-butyric acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1209561 | Beilstein |
| CAS:2382-59-4 | ChemIDplus |