EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37032 - 3-hydroxy-5-oxohexanoic acid
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | CC(=O)CC(O)CC(=O)O |
| InChI | InChI=1S/C6H10O4/c1-4(7)2-5(8)3-6(9)10/h5,8H,2-3H2,1H3,(H,9,10) |
| InChIKey | APWDZEIBFNZVND-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) has functional parent hexanoic acid (CHEBI:30776) |
| 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) is a 5-oxo monocarboxylic acid (CHEBI:35952) |
| 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) is conjugate acid of 3-hydroxy-5-oxohexanoate (CHEBI:20051) |
| Incoming Relation(s) |
| 3-hydroxy-5-oxohexanoyl-CoA (CHEBI:20052) has functional parent 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) |
| 3-hydroxy-5-oxohexanoate (CHEBI:20051) is conjugate base of 3-hydroxy-5-oxohexanoic acid (CHEBI:37032) |
| IUPAC Name |
|---|
| 3-hydroxy-5-oxohexanoic acid |
| Synonym | Source |
|---|---|
| 3-Hydroxy-5-ketohexanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16272 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:109138-72-9 | ChemIDplus |
| CAS:109138-72-9 | KEGG COMPOUND |