EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O7PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 213.103 |
| Monoisotopic Mass (excl. R groups) | 213.01641 |
| SMILES | *[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribonucleoside 3'-monophosphate (CHEBI:37009) is a ribonucleoside 3'-phosphate (CHEBI:37013) |
| ribonucleoside 3'-monophosphate (CHEBI:37009) is a ribonucleoside monophosphate (CHEBI:26558) |
| ribonucleoside 3'-monophosphate (CHEBI:37009) is conjugate acid of ribonucleoside 3'-monophosphate(2−) (CHEBI:13197) |
| Incoming Relation(s) |
| 3'-O-phosphono-ADP-[(3R)-27-amino-3-hydroxy-2,2-dimethyl-4,8,14-trioxo-12-thia-5,9,15,19,24-pentaazaheptacosane] (CHEBI:44310) is a ribonucleoside 3'-monophosphate (CHEBI:37009) |
| 7-Methyl-2'-deoxyguanosine-3'-monophosphate (CHEBI:230670) is a ribonucleoside 3'-monophosphate (CHEBI:37009) |
| B-factor (CHEBI:222719) is a ribonucleoside 3'-monophosphate (CHEBI:37009) |
| purine ribonucleoside 3'-monophosphate (CHEBI:37020) is a ribonucleoside 3'-monophosphate (CHEBI:37009) |
| pyrimidine ribonucleoside 3'-monophosphate (CHEBI:37018) is a ribonucleoside 3'-monophosphate (CHEBI:37009) |
| ribonucleoside 3'-monophosphate(2−) (CHEBI:13197) is conjugate base of ribonucleoside 3'-monophosphate (CHEBI:37009) |
| Synonyms | Source |
|---|---|
| 3'-Nucleoside monophosphate | KEGG COMPOUND |
| 3'-Phosphomononucleotides | KEGG COMPOUND |
| 3'-phosphoribonucleotides | ChEBI |
| 3'-Ribonucleotide | KEGG COMPOUND |
| ribonucleoside 3'-monophosphates | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02508 | KEGG COMPOUND |