EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2 |
| Net Charge | 0 |
| Average Mass | 148.209 |
| Monoisotopic Mass | 148.10005 |
| SMILES | [H][C@]1(c2cccnc2)CCCN1 |
| InChI | InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/t9-/m1/s1 |
| InChIKey | MYKUKUCHPMASKF-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12194923) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Nornicotine (CHEBI:37) is a pyridines (CHEBI:26421) |
| (+)-Nornicotine (CHEBI:37) is a pyrrolidines (CHEBI:38260) |
| (+)-Nornicotine (CHEBI:37) is enantiomer of (S)-nornicotine (CHEBI:28313) |
| Incoming Relation(s) |
| (S)-nornicotine (CHEBI:28313) is enantiomer of (+)-Nornicotine (CHEBI:37) |
| Synonyms | Source |
|---|---|
| (+)-Nornicotine | KEGG COMPOUND |
| 3-(pyrrolidin-2-yl)pyridine | HMDB |
| (R,S)-Nornicotine | HMDB |
| Nornicotin | HMDB |
| (+-)-1'-demethyl-Nicotine | HMDB |
| (R)-3-(Pyrrolidin-2-yl)pyridine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C11360 | KEGG COMPOUND |
| C00002061 | KNApSAcK |
| CPD-2748 | MetaCyc |
| HMDB0001126 | HMDB |
| LSM-5009 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:7076-23-5 | KEGG COMPOUND |
| CAS:494-97-3 | KEGG COMPOUND |
| Citations |
|---|