EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O5S |
| Net Charge | 0 |
| Average Mass | 358.460 |
| Monoisotopic Mass | 358.15624 |
| SMILES | CC1(C)C[C@@H]1C(=O)N/C(=C\CCCCSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N2O5S/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/b12-6-/t10-,11+/m1/s1 |
| InChIKey | DHSUYTOATWAVLW-WFVMDLQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 3.4.13.19 (membrane dipeptidase) inhibitor An EC 3.4.13.* (dipeptidase) inhibitor that interferes with the action of membrane dipeptidase (EC 3.4.13.19). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilastatin (CHEBI:3697) has role EC 3.4.13.19 (membrane dipeptidase) inhibitor (CHEBI:76926) |
| cilastatin (CHEBI:3697) has role environmental contaminant (CHEBI:78298) |
| cilastatin (CHEBI:3697) has role protease inhibitor (CHEBI:37670) |
| cilastatin (CHEBI:3697) has role xenobiotic (CHEBI:35703) |
| cilastatin (CHEBI:3697) is a L-cysteine derivative (CHEBI:83824) |
| cilastatin (CHEBI:3697) is a carboxamide (CHEBI:37622) |
| cilastatin (CHEBI:3697) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| cilastatin (CHEBI:3697) is a organic sulfide (CHEBI:16385) |
| cilastatin (CHEBI:3697) is conjugate acid of cilastatin(1−) (CHEBI:59512) |
| Incoming Relation(s) |
| cilastatin(1−) (CHEBI:59512) is conjugate base of cilastatin (CHEBI:3697) |
| IUPAC Name |
|---|
| (2Z)-7-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)hept-2-enoic acid |
| INNs | Source |
|---|---|
| cilastatin | ChemIDplus |
| cilastatina | ChemIDplus |
| cilastatine | ChemIDplus |
| cilastatinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (Z)-(S)-6-carboxy-6-[(S)-2,2-dimethylcyclopropanecarboxamido]hex-5-enyl-L-cysteine | ChEBI |
| (L)-7-(2-Amino-2-carboxy-ethylsulfanyl)-2-[(2,2-dimethyl-cyclopropanecarbonyl)-amino]-hept-2-enoic acid | ChEMBL |
| (Z)-7-((R)-2-Amino-2-carboxy-ethylsulfanyl)-2-[((S)-2,2-dimethyl-cyclopropanecarbonyl)-amino]-hept-2-enoic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6895069 | Reaxys |
| CAS:82009-34-5 | ChemIDplus |
| CAS:82009-34-5 | KEGG COMPOUND |
| Citations |
|---|