EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH2O2S |
| Net Charge | 0 |
| Average Mass | 78.092 |
| Monoisotopic Mass | 77.97755 |
| SMILES | O=C(O)S |
| InChI | InChI=1S/CH2O2S/c2-1(3)4/h4H,(H,2,3) |
| InChIKey | HDFRDWFLWVCOGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbonothioic O,S-acid (CHEBI:36959) is a carbonothioic acid (CHEBI:36960) |
| carbonothioic O,S-acid (CHEBI:36959) is a one-carbon compound (CHEBI:64708) |
| carbonothioic O,S-acid (CHEBI:36959) is tautomer of carbonothioic O,O-acid (CHEBI:36958) |
| Incoming Relation(s) |
| carbonothioic O,O-acid (CHEBI:36958) is tautomer of carbonothioic O,S-acid (CHEBI:36959) |
| IUPAC Names |
|---|
| carbonothioic S-acid |
| hydroxidooxidosulfanidocarbon |
| Synonyms | Source |
|---|---|
| carbonothioic O,S-acid | IUPAC |
| [CO(OH)(SH)] | ChEBI |
| HO‒CO‒SH | IUPAC |