EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21ClN2O2 |
| Net Charge | 0 |
| Average Mass | 284.787 |
| Monoisotopic Mass | 284.12916 |
| SMILES | COCCCC/C(=N\OCCN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-18-10-3-2-4-14(17-19-11-9-16)12-5-7-13(15)8-6-12/h5-8H,2-4,9-11,16H2,1H3/b17-14+ |
| InChIKey | XXPVSQRPGBUFKM-SAPNQHFASA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clovoxamine (CHEBI:36813) has role antidepressant (CHEBI:35469) |
| clovoxamine (CHEBI:36813) is a 5-methoxyvalerophenone O-(2-aminoethyl)oxime (CHEBI:36815) |
| clovoxamine (CHEBI:36813) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| (1E)-1-(4-chlorophenyl)-5-methoxypentan-1-one O-(2-aminoethyl)oxime |
| Synonyms | Source |
|---|---|
| 4'-chloro-5-methoxyvalerophenone (E)-O-(2-aminoethyl)oxime | ChemIDplus |
| Clovoxamin | ChEBI |
| clovoxamine | ChemIDplus |
| clovoxaminum | ChemIDplus |
| p-chloro-5-methoxyvalerophenone (E)-O-(2-aminoethyl)oxime | ChemIDplus |
| (E)-1-(4-chlorophenyl)-5-methoxy-1-pentanone O-(2-aminoethyl)oxime | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:54739-19-4 | ChemIDplus |