EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22NS.Cl |
| Net Charge | 0 |
| Average Mass | 331.912 |
| Monoisotopic Mass | 331.11615 |
| SMILES | [Cl-].[H][N+](C)(C)CC/C=C1/c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C19H21NS.ClH/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19;/h3-6,8-12H,7,13-14H2,1-2H3;1H/b17-11-; |
| InChIKey | XUPZAARQDNSRJB-CULRIWENSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-dothiepin hydrochloride (CHEBI:36804) has part cis-dothiepin (CHEBI:36802) |
| cis-dothiepin hydrochloride (CHEBI:36804) is a dothiepin hydrochloride (CHEBI:31519) |
| IUPAC Name |
|---|
| (3Z)-3-dibenzo[b,e]thiepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine hydrochloride |
| Synonym | Source |
|---|---|
| cis-11-(3-dimethylaminopropylidene)-6,11-dihydrodibenzo(b,e)thiepin hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5892556 | Beilstein |
| CAS:25627-39-8 | ChemIDplus |