EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18ClNO |
| Net Charge | 0 |
| Average Mass | 239.746 |
| Monoisotopic Mass | 239.10769 |
| SMILES | C[C@@H](NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3/t9-/m1/s1 |
| InChIKey | SNPPWIUOZRMYNY-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-bupropion (CHEBI:36794) is a bupropion (CHEBI:3219) |
| (R)-bupropion (CHEBI:36794) is enantiomer of (S)-bupropion (CHEBI:36793) |
| Incoming Relation(s) |
| (S)-bupropion (CHEBI:36793) is enantiomer of (R)-bupropion (CHEBI:36794) |
| IUPAC Name |
|---|
| (2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8684199 | Beilstein |