EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O6 |
| Net Charge | 0 |
| Average Mass | 350.411 |
| Monoisotopic Mass | 350.17294 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@@](C1)(C[C@@]2(C)O)[C@@H](C(=O)O)[C@@]1([H])[C@@]32CC[C@H](O)[C@@]1(C)C(=O)O2 |
| InChI | InChI=1S/C19H26O6/c1-16(24)8-18-7-9(16)3-4-10(18)19-6-5-11(20)17(2,15(23)25-19)13(19)12(18)14(21)22/h9-13,20,24H,3-8H2,1-2H3,(H,21,22)/t9-,10-,11+,12-,13-,16-,17-,18-,19-/m1/s1 |
| InChIKey | OJDCBRZJXYBPFZ-UIEKCWFXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A2 (CHEBI:36774) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A2 (CHEBI:36774) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A2 (CHEBI:36774) is a lactone (CHEBI:25000) |
| Incoming Relation(s) |
| gibberellin A2 O-β-D-glucoside (CHEBI:28153) has functional parent gibberellin A2 (CHEBI:36774) |
| IUPAC Names |
|---|
| (1R,2R,5R,6R,8R,9S,10R,11S,12S)-6,12-dihydroxy-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 2β,8α-dihydroxy-1α,8-dimethyl-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| (1S,2S,4aR,4bR,7R,8R,9aR,10S,10aR)-2,8-dihydroxy-1,8-dimethyl-13-oxododecahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid | ChEBI |
| GA2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5135673 | Reaxys |
| Citations |
|---|